C37H35F13O5 — CID 101363344
[4-[(2S)-nonan-2-yl]oxycarbonylphenyl] 4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenyl]benzoate (PubChem CID 101363344) has the molecular formula C37H35F13O5 and a molecular weight of 806.66 g/mol. Its IUPAC name is [4-[(2S)-nonan-2-yl]oxycarbonylphenyl] 4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenyl]benzoate.
| Compound Name | [4-[(2S)-nonan-2-yl]oxycarbonylphenyl] 4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 101363344 |
| Molecular Formula | C37H35F13O5 |
| Molecular Weight | 806.66 g/mol |
| Exact Mass | 806.23 |
| IUPAC Name | [4-[(2S)-nonan-2-yl]oxycarbonylphenyl] 4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenyl]benzoate |
| SMILES | CCCCCCC[C@H](C)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H35F13O5/c1-3-4-5-6-7-8-23(2)54-30(51)27-15-19-29(20-16-27)55-31(52)26-11-9-24(10-12-26)25-13-17-28(18-14-25)53-22-21-32(38,39)33(40,41)34(42,43)35(44,45)36(46,47)37(48,49)50/h9-20,23H,3-8,21-22H2,1-2H3/t23-/m0/s1 |
| InChIKey | MZJXSPJKLPRVET-QHCPKHFHSA-N |
| XLogP | 11.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.66 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|