C38H35F15O6 — CID 132515531
[4-[4-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyloxy)propoxy]phenyl]phenyl] 4-octan-2-yloxybenzoate (PubChem CID 132515531) has the molecular formula C38H35F15O6 and a molecular weight of 872.66 g/mol. Its IUPAC name is [4-[4-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyloxy)propoxy]phenyl]phenyl] 4-octan-2-yloxybenzoate.
| Compound Name | [4-[4-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyloxy)propoxy]phenyl]phenyl] 4-octan-2-yloxybenzoate |
|---|---|
| PubChem CID | 132515531 |
| Molecular Formula | C38H35F15O6 |
| Molecular Weight | 872.66 g/mol |
| Exact Mass | 872.22 |
| IUPAC Name | [4-[4-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyloxy)propoxy]phenyl]phenyl] 4-octan-2-yloxybenzoate |
| SMILES | CCCCCCC(C)Oc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H35F15O6/c1-3-4-5-6-8-23(2)58-28-19-13-26(14-20-28)30(54)59-29-17-11-25(12-18-29)24-9-15-27(16-10-24)56-21-7-22-57-31(55)32(39,40)33(41,42)34(43,44)35(45,46)36(47,48)37(49,50)38(51,52)53/h9-20,23H,3-8,21-22H2,1-2H3 |
| InChIKey | NQTJBHBOWHJGRH-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.66 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|