C34H44O4 — CID 67858794
[4-[4-(4-methylhexoxy)phenyl]phenyl] 4-[(2R)-octan-2-yl]oxybenzoate (PubChem CID 67858794) has the molecular formula C34H44O4 and a molecular weight of 516.72 g/mol. Its IUPAC name is [4-[4-(4-methylhexoxy)phenyl]phenyl] 4-[(2R)-octan-2-yl]oxybenzoate.
| Compound Name | [4-[4-(4-methylhexoxy)phenyl]phenyl] 4-[(2R)-octan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 67858794 |
| Molecular Formula | C34H44O4 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | [4-[4-(4-methylhexoxy)phenyl]phenyl] 4-[(2R)-octan-2-yl]oxybenzoate |
| SMILES | CCCCCC[C@@H](C)Oc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H44O4/c1-5-7-8-9-12-27(4)37-32-23-17-30(18-24-32)34(35)38-33-21-15-29(16-22-33)28-13-19-31(20-14-28)36-25-10-11-26(3)6-2/h13-24,26-27H,5-12,25H2,1-4H3/t26?,27-/m1/s1 |
| InChIKey | NLRNWQIZXQOZBL-SSYAZFEXSA-N |
| XLogP | 9.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|