C38H50O6 — CID 102137827
[4-[4-(3-octanoyloxypropoxy)phenyl]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate (PubChem CID 102137827) has the molecular formula C38H50O6 and a molecular weight of 602.81 g/mol. Its IUPAC name is [4-[4-(3-octanoyloxypropoxy)phenyl]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate.
| Compound Name | [4-[4-(3-octanoyloxypropoxy)phenyl]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 102137827 |
| Molecular Formula | C38H50O6 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | [4-[4-(3-octanoyloxypropoxy)phenyl]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate |
| SMILES | CCCCCCCC(=O)OCCCOc1ccc(-c2ccc(OC(=O)c3ccc(O[C@@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H50O6/c1-4-6-8-10-12-15-37(39)42-29-13-28-41-34-22-16-31(17-23-34)32-18-24-36(25-19-32)44-38(40)33-20-26-35(27-21-33)43-30(3)14-11-9-7-5-2/h16-27,30H,4-15,28-29H2,1-3H3/t30-/m0/s1 |
| InChIKey | OGMPUPNQUPOKAE-PMERELPUSA-N |
| XLogP | 9.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|