C32H44O7 — CID 102216565
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(6-butanoyloxyhexoxy)benzoate (PubChem CID 102216565) has the molecular formula C32H44O7 and a molecular weight of 540.70 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(6-butanoyloxyhexoxy)benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(6-butanoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 102216565 |
| Molecular Formula | C32H44O7 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(6-butanoyloxyhexoxy)benzoate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(OC(=O)c2ccc(OCCCCCCOC(=O)CCC)cc2)cc1 |
| InChI | InChI=1S/C32H44O7/c1-4-6-7-10-14-25(3)38-31(34)26-17-21-29(22-18-26)39-32(35)27-15-19-28(20-16-27)36-23-11-8-9-12-24-37-30(33)13-5-2/h15-22,25H,4-14,23-24H2,1-3H3/t25-/m0/s1 |
| InChIKey | GKGRFFHHVJGEQR-VWLOTQADSA-N |
| XLogP | 7.70 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|