C37H41F5O7 — CID 102216560
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-(2,2,3,3,3-pentafluoropropanoyloxy)hexoxy]phenyl]benzoate (PubChem CID 102216560) has the molecular formula C37H41F5O7 and a molecular weight of 692.72 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-(2,2,3,3,3-pentafluoropropanoyloxy)hexoxy]phenyl]benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-(2,2,3,3,3-pentafluoropropanoyloxy)hexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 102216560 |
| Molecular Formula | C37H41F5O7 |
| Molecular Weight | 692.72 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-(2,2,3,3,3-pentafluoropropanoyloxy)hexoxy]phenyl]benzoate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCOC(=O)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H41F5O7/c1-3-4-5-8-11-26(2)48-33(43)30-18-22-32(23-19-30)49-34(44)29-14-12-27(13-15-29)28-16-20-31(21-17-28)46-24-9-6-7-10-25-47-35(45)36(38,39)37(40,41)42/h12-23,26H,3-11,24-25H2,1-2H3/t26-/m0/s1 |
| InChIKey | WLPUJZRGHZRHNG-SANMLTNESA-N |
| XLogP | 9.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.72 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|