C38H41F9O6 — CID 102420131
(4-octan-2-yloxyphenyl) 4-[4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexoxy]phenyl]benzoate (PubChem CID 102420131) has the molecular formula C38H41F9O6 and a molecular weight of 764.72 g/mol. Its IUPAC name is (4-octan-2-yloxyphenyl) 4-[4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexoxy]phenyl]benzoate.
| Compound Name | (4-octan-2-yloxyphenyl) 4-[4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 102420131 |
| Molecular Formula | C38H41F9O6 |
| Molecular Weight | 764.72 g/mol |
| Exact Mass | 764.28 |
| IUPAC Name | (4-octan-2-yloxyphenyl) 4-[4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexoxy]phenyl]benzoate |
| SMILES | CCCCCCC(C)Oc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H41F9O6/c1-3-4-5-8-11-26(2)52-31-20-22-32(23-21-31)53-33(48)29-14-12-27(13-15-29)28-16-18-30(19-17-28)50-24-9-6-7-10-25-51-34(49)35(39,40)36(41,42)37(43,44)38(45,46)47/h12-23,26H,3-11,24-25H2,1-2H3 |
| InChIKey | MOZWOCRIKDNOHV-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.72 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|