C39H41F9O6 — CID 102216695
[4-(4-octan-2-yloxycarbonylphenyl)phenyl] 4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexyl]benzoate (PubChem CID 102216695) has the molecular formula C39H41F9O6 and a molecular weight of 776.73 g/mol. Its IUPAC name is [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexyl]benzoate.
| Compound Name | [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexyl]benzoate |
|---|---|
| PubChem CID | 102216695 |
| Molecular Formula | C39H41F9O6 |
| Molecular Weight | 776.73 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | [4-(4-octan-2-yloxycarbonylphenyl)phenyl] 4-[6-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)hexyl]benzoate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H41F9O6/c1-3-4-5-8-11-26(2)53-33(49)31-19-17-28(18-20-31)29-21-23-32(24-22-29)54-34(50)30-15-13-27(14-16-30)12-9-6-7-10-25-52-35(51)36(40,41)37(42,43)38(44,45)39(46,47)48/h13-24,26H,3-12,25H2,1-2H3 |
| InChIKey | PHHULPSDCWDHNH-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.73 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|