C32H40O4 — CID 14669785
(4-pentoxyphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzoate (PubChem CID 14669785) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (4-pentoxyphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzoate.
| Compound Name | (4-pentoxyphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 14669785 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (4-pentoxyphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzoate |
| SMILES | CCCCCC[C@H](C)Oc1ccc(-c2ccc(C(=O)Oc3ccc(OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H40O4/c1-4-6-8-9-11-25(3)35-30-18-16-27(17-19-30)26-12-14-28(15-13-26)32(33)36-31-22-20-29(21-23-31)34-24-10-7-5-2/h12-23,25H,4-11,24H2,1-3H3/t25-/m0/s1 |
| InChIKey | YNNNCXUDPRPGCR-VWLOTQADSA-N |
| XLogP | 8.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|