C32H46O4 — CID 67948233
[4-[(Z)-undec-5-enoxy]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate (PubChem CID 67948233) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is [4-[(Z)-undec-5-enoxy]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate.
| Compound Name | [4-[(Z)-undec-5-enoxy]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 67948233 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [4-[(Z)-undec-5-enoxy]phenyl] 4-[(2S)-octan-2-yl]oxybenzoate |
| SMILES | CCCCC/C=C\CCCCOc1ccc(OC(=O)c2ccc(O[C@@H](C)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H46O4/c1-4-6-8-10-11-12-13-14-16-26-34-29-22-24-31(25-23-29)36-32(33)28-18-20-30(21-19-28)35-27(3)17-15-9-7-5-2/h11-12,18-25,27H,4-10,13-17,26H2,1-3H3/b12-11-/t27-/m0/s1 |
| InChIKey | UJLDSJKOLUXYTD-VMAVNYORSA-N |
| XLogP | 9.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|