C31H44O4 — CID 67948173
(4-non-5-enoxyphenyl) 4-(6-methyloctoxy)benzoate (PubChem CID 67948173) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is (4-non-5-enoxyphenyl) 4-(6-methyloctoxy)benzoate.
| Compound Name | (4-non-5-enoxyphenyl) 4-(6-methyloctoxy)benzoate |
|---|---|
| PubChem CID | 67948173 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (4-non-5-enoxyphenyl) 4-(6-methyloctoxy)benzoate |
| SMILES | CCCC=CCCCCOc1ccc(OC(=O)c2ccc(OCCCCCC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C31H44O4/c1-4-6-7-8-9-10-13-24-34-29-20-22-30(23-21-29)35-31(32)27-16-18-28(19-17-27)33-25-14-11-12-15-26(3)5-2/h7-8,16-23,26H,4-6,9-15,24-25H2,1-3H3 |
| InChIKey | FDTQSCHRXJZYNL-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|