C29H40O4 — CID 67948711
[4-[(6S)-6-methyloctoxy]phenyl] 4-[(E)-hept-1-enoxy]benzoate (PubChem CID 67948711) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is [4-[(6S)-6-methyloctoxy]phenyl] 4-[(E)-hept-1-enoxy]benzoate.
| Compound Name | [4-[(6S)-6-methyloctoxy]phenyl] 4-[(E)-hept-1-enoxy]benzoate |
|---|---|
| PubChem CID | 67948711 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [4-[(6S)-6-methyloctoxy]phenyl] 4-[(E)-hept-1-enoxy]benzoate |
| SMILES | CCCCC/C=C/Oc1ccc(C(=O)Oc2ccc(OCCCCC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C29H40O4/c1-4-6-7-8-11-22-31-26-16-14-25(15-17-26)29(30)33-28-20-18-27(19-21-28)32-23-12-9-10-13-24(3)5-2/h11,14-22,24H,4-10,12-13,23H2,1-3H3/b22-11+/t24-/m0/s1 |
| InChIKey | VQDJIEBTDMMQDG-SPVXFMEISA-N |
| XLogP | 8.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|