C30H42O4 — CID 67948424
[4-[(Z)-oct-5-enoxy]phenyl] 4-[(6S)-6-methyloctoxy]benzoate (PubChem CID 67948424) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is [4-[(Z)-oct-5-enoxy]phenyl] 4-[(6S)-6-methyloctoxy]benzoate.
| Compound Name | [4-[(Z)-oct-5-enoxy]phenyl] 4-[(6S)-6-methyloctoxy]benzoate |
|---|---|
| PubChem CID | 67948424 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [4-[(Z)-oct-5-enoxy]phenyl] 4-[(6S)-6-methyloctoxy]benzoate |
| SMILES | CC/C=C\CCCCOc1ccc(OC(=O)c2ccc(OCCCCC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C30H42O4/c1-4-6-7-8-9-12-23-33-28-19-21-29(22-20-28)34-30(31)26-15-17-27(18-16-26)32-24-13-10-11-14-25(3)5-2/h6-7,15-22,25H,4-5,8-14,23-24H2,1-3H3/b7-6-/t25-/m0/s1 |
| InChIKey | YJBRTZMBBZKEGE-KBDOHKNDSA-N |
| XLogP | 8.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|