C26H34O4 — CID 54447815
(4-but-3-enoxyphenyl) 4-[(6S)-6-methyloctoxy]benzoate (PubChem CID 54447815) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (4-but-3-enoxyphenyl) 4-[(6S)-6-methyloctoxy]benzoate.
| Compound Name | (4-but-3-enoxyphenyl) 4-[(6S)-6-methyloctoxy]benzoate |
|---|---|
| PubChem CID | 54447815 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (4-but-3-enoxyphenyl) 4-[(6S)-6-methyloctoxy]benzoate |
| SMILES | C=CCCOc1ccc(OC(=O)c2ccc(OCCCCC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C26H34O4/c1-4-6-19-28-24-15-17-25(18-16-24)30-26(27)22-11-13-23(14-12-22)29-20-9-7-8-10-21(3)5-2/h4,11-18,21H,1,5-10,19-20H2,2-3H3/t21-/m0/s1 |
| InChIKey | WSUFXNMFYIKEOW-NRFANRHFSA-N |
| XLogP | 6.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|