C32H38O4 — CID 54538599
[4-[(4S)-4-methylhexoxy]phenyl] 4-(4-hex-5-enoxyphenyl)benzoate (PubChem CID 54538599) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is [4-[(4S)-4-methylhexoxy]phenyl] 4-(4-hex-5-enoxyphenyl)benzoate.
| Compound Name | [4-[(4S)-4-methylhexoxy]phenyl] 4-(4-hex-5-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 54538599 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [4-[(4S)-4-methylhexoxy]phenyl] 4-(4-hex-5-enoxyphenyl)benzoate |
| SMILES | C=CCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OCCC[C@@H](C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H38O4/c1-4-6-7-8-23-34-29-17-15-27(16-18-29)26-11-13-28(14-12-26)32(33)36-31-21-19-30(20-22-31)35-24-9-10-25(3)5-2/h4,11-22,25H,1,5-10,23-24H2,2-3H3/t25-/m0/s1 |
| InChIKey | ZBNGKSKCDQMJJT-VWLOTQADSA-N |
| XLogP | 8.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|