C30H34O4 — CID 175207098
[4-[4-[(2S)-2-methylbutoxy]phenyl]phenyl] 4-hex-5-enoxybenzoate (PubChem CID 175207098) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is [4-[4-[(2S)-2-methylbutoxy]phenyl]phenyl] 4-hex-5-enoxybenzoate.
| Compound Name | [4-[4-[(2S)-2-methylbutoxy]phenyl]phenyl] 4-hex-5-enoxybenzoate |
|---|---|
| PubChem CID | 175207098 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [4-[4-[(2S)-2-methylbutoxy]phenyl]phenyl] 4-hex-5-enoxybenzoate |
| SMILES | C=CCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC[C@@H](C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O4/c1-4-6-7-8-21-32-27-17-13-26(14-18-27)30(31)34-29-19-11-25(12-20-29)24-9-15-28(16-10-24)33-22-23(3)5-2/h4,9-20,23H,1,5-8,21-22H2,2-3H3/t23-/m0/s1 |
| InChIKey | YMHFQMVWBBEEES-QHCPKHFHSA-N |
| XLogP | 7.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|