C42H52O9 — CID 102468863
[4-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-undec-10-enoxyphenyl)benzoate (PubChem CID 102468863) has the molecular formula C42H52O9 and a molecular weight of 700.87 g/mol. Its IUPAC name is [4-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-undec-10-enoxyphenyl)benzoate.
| Compound Name | [4-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-undec-10-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102468863 |
| Molecular Formula | C42H52O9 |
| Molecular Weight | 700.87 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | [4-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-undec-10-enoxyphenyl)benzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(=O)OC(C)C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H52O9/c1-6-8-9-10-11-12-13-14-15-28-47-37-24-20-34(21-25-37)33-16-18-35(19-17-33)42(46)51-38-26-22-36(23-27-38)41(45)50-32(5)40(44)49-31(4)39(43)48-29-30(3)7-2/h6,16-27,30-32H,1,7-15,28-29H2,2-5H3 |
| InChIKey | VHANZBOKXXYVDF-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.87 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|