C37H44O9 — CID 102071878
[4-[1-(1-hexoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate (PubChem CID 102071878) has the molecular formula C37H44O9 and a molecular weight of 632.75 g/mol. Its IUPAC name is [4-[1-(1-hexoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate.
| Compound Name | [4-[1-(1-hexoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102071878 |
| Molecular Formula | C37H44O9 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | [4-[1-(1-hexoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate |
| SMILES | CCCCCCOC(=O)C(C)OC(=O)C(C)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H44O9/c1-5-7-9-11-25-43-34(38)26(3)44-35(39)27(4)45-36(40)31-18-22-33(23-19-31)46-37(41)30-14-12-28(13-15-30)29-16-20-32(21-17-29)42-24-10-8-6-2/h12-23,26-27H,5-11,24-25H2,1-4H3 |
| InChIKey | VCEFBPLDMAAHJX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|