C43H47ClO9 — CID 101213626
[4-[4-(1-hexoxy-1-oxopropan-2-yl)oxycarbonylphenoxy]carbonylphenyl] 4-(3-chloro-4-heptoxyphenyl)benzoate (PubChem CID 101213626) has the molecular formula C43H47ClO9 and a molecular weight of 743.29 g/mol. Its IUPAC name is [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxycarbonylphenoxy]carbonylphenyl] 4-(3-chloro-4-heptoxyphenyl)benzoate.
| Compound Name | [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxycarbonylphenoxy]carbonylphenyl] 4-(3-chloro-4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101213626 |
| Molecular Formula | C43H47ClO9 |
| Molecular Weight | 743.29 g/mol |
| Exact Mass | 742.29 |
| IUPAC Name | [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxycarbonylphenoxy]carbonylphenyl] 4-(3-chloro-4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)Oc4ccc(C(=O)OC(C)C(=O)OCCCCCC)cc4)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C43H47ClO9/c1-4-6-8-10-12-27-49-39-26-21-35(29-38(39)44)31-13-15-32(16-14-31)42(47)52-37-24-19-34(20-25-37)43(48)53-36-22-17-33(18-23-36)41(46)51-30(3)40(45)50-28-11-9-7-5-2/h13-26,29-30H,4-12,27-28H2,1-3H3 |
| InChIKey | VYWBLFGKMJJXOQ-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.29 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|