C39H50O8 — CID 101388009
[4-[1-(2-butoxyethoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-decoxyphenyl)benzoate (PubChem CID 101388009) has the molecular formula C39H50O8 and a molecular weight of 646.82 g/mol. Its IUPAC name is [4-[1-(2-butoxyethoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-decoxyphenyl)benzoate.
| Compound Name | [4-[1-(2-butoxyethoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-decoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101388009 |
| Molecular Formula | C39H50O8 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | [4-[1-(2-butoxyethoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-decoxyphenyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(=O)OCCOCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H50O8/c1-4-6-8-9-10-11-12-13-27-44-35-22-18-32(19-23-35)31-14-16-33(17-15-31)39(42)47-36-24-20-34(21-25-36)38(41)46-30(3)37(40)45-29-28-43-26-7-5-2/h14-25,30H,4-13,26-29H2,1-3H3 |
| InChIKey | JVWHJOFKWRGOIS-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|