C36H46O6 — CID 14419460
(4-octoxyphenyl) 4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenyl]benzoate (PubChem CID 14419460) has the molecular formula C36H46O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is (4-octoxyphenyl) 4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenyl]benzoate.
| Compound Name | (4-octoxyphenyl) 4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenyl]benzoate |
|---|---|
| PubChem CID | 14419460 |
| Molecular Formula | C36H46O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | (4-octoxyphenyl) 4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(OC(C)C(=O)OCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H46O6/c1-4-6-8-10-11-13-26-39-32-22-24-34(25-23-32)42-36(38)31-16-14-29(15-17-31)30-18-20-33(21-19-30)41-28(3)35(37)40-27-12-9-7-5-2/h14-25,28H,4-13,26-27H2,1-3H3 |
| InChIKey | AWUDSIIMQSTPRG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|