C37H48O6 — CID 101003152
[4-[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxyphenyl]phenyl] 4-decoxybenzoate (PubChem CID 101003152) has the molecular formula C37H48O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is [4-[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxyphenyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxyphenyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 101003152 |
| Molecular Formula | C37H48O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | [4-[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxyphenyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(C)C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H48O6/c1-5-7-8-9-10-11-12-13-26-40-33-20-18-32(19-21-33)37(39)43-35-24-16-31(17-25-35)30-14-22-34(23-15-30)42-29(4)36(38)41-27-28(3)6-2/h14-25,28-29H,5-13,26-27H2,1-4H3 |
| InChIKey | XCXYQOLHABILBM-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|