C30H33O6- — CID 18637919
(2R)-2-[4-[4-(4-octoxyphenyl)benzoyl]oxyphenoxy]propanoate (PubChem CID 18637919) has the molecular formula C30H33O6- and a molecular weight of 489.59 g/mol. Its IUPAC name is (2R)-2-[4-[4-(4-octoxyphenyl)benzoyl]oxyphenoxy]propanoate.
| Compound Name | (2R)-2-[4-[4-(4-octoxyphenyl)benzoyl]oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 18637919 |
| Molecular Formula | C30H33O6- |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (2R)-2-[4-[4-(4-octoxyphenyl)benzoyl]oxyphenoxy]propanoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(O[C@H](C)C(=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O6/c1-3-4-5-6-7-8-21-34-26-15-13-24(14-16-26)23-9-11-25(12-10-23)30(33)36-28-19-17-27(18-20-28)35-22(2)29(31)32/h9-20,22H,3-8,21H2,1-2H3,(H,31,32)/p-1/t22-/m1/s1 |
| InChIKey | KNWUFRKMIBMFHB-JOCHJYFZSA-M |
| XLogP | 5.83 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|