C39H52O6 — CID 102214569
[4-[4-(1-heptan-4-yloxy-1-oxopropan-2-yl)oxyphenyl]phenyl] 4-decoxybenzoate (PubChem CID 102214569) has the molecular formula C39H52O6 and a molecular weight of 616.84 g/mol. Its IUPAC name is [4-[4-(1-heptan-4-yloxy-1-oxopropan-2-yl)oxyphenyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[4-(1-heptan-4-yloxy-1-oxopropan-2-yl)oxyphenyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 102214569 |
| Molecular Formula | C39H52O6 |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | [4-[4-(1-heptan-4-yloxy-1-oxopropan-2-yl)oxyphenyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(C)C(=O)OC(CCC)CCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H52O6/c1-5-8-9-10-11-12-13-14-29-42-34-23-21-33(22-24-34)39(41)45-37-27-19-32(20-28-37)31-17-25-36(26-18-31)43-30(4)38(40)44-35(15-6-2)16-7-3/h17-28,30,35H,5-16,29H2,1-4H3 |
| InChIKey | VUFRTOLXBRNJSF-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|