C35H46O4 — CID 14669812
[4-(4-octoxyphenyl)phenyl] 4-octan-2-yloxybenzoate (PubChem CID 14669812) has the molecular formula C35H46O4 and a molecular weight of 530.75 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 4-octan-2-yloxybenzoate.
| Compound Name | [4-(4-octoxyphenyl)phenyl] 4-octan-2-yloxybenzoate |
|---|---|
| PubChem CID | 14669812 |
| Molecular Formula | C35H46O4 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 4-octan-2-yloxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H46O4/c1-4-6-8-10-11-13-27-37-32-21-15-29(16-22-32)30-17-23-34(24-18-30)39-35(36)31-19-25-33(26-20-31)38-28(3)14-12-9-7-5-2/h15-26,28H,4-14,27H2,1-3H3 |
| InChIKey | LRDBJIDRSWINCK-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|