About [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate
[4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate (PubChem CID 54149036) has the molecular formula C32H46O4
and a molecular weight of 494.72 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate.
Molecular Properties
| Compound Name | [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate |
| PubChem CID | 54149036 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(O[C@@H](C)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H46O4/c1-4-6-8-10-11-12-13-14-16-26-34-29-20-18-28(19-21-29)32(33)36-31-24-22-30(23-25-31)35-27(3)17-15-9-7-5-2/h4,18-25,27H,1,5-17,26H2,2-3H3/t27-/m0/s1 |
| InChIKey | OGKZKMRNCDVUFU-MHZLTWQESA-N |
| XLogP | 9.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate?
The IUPAC name of [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate (CID 54149036) is [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate.
What is the SMILES notation for [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate?
The canonical SMILES for [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate is C=CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(O[C@@H](C)CCCCCC)cc2)cc1.
What is the InChIKey of [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate?
The InChIKey is OGKZKMRNCDVUFU-MHZLTWQESA-N. The full InChI is InChI=1S/C32H46O4/c1-4-6-8-10-11-12-13-14-16-26-34-29-20-18-28(19-21-29)32(33)36-31-24-22-30(23-25-31)35-27(3)17-15-9-7-5-2/h4,18-25,27H,1,5-17,26H2,2-3H3/t27-/m0/s1.
What are the key properties of [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate?
[4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate has a molecular weight of 494.72 g/mol, XLogP of 9.33, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2S)-octan-2-yl]oxyphenyl] 4-undec-10-enoxybenzoate is sourced from PubChem (CID 54149036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).