About (4-non-8-enoxyphenyl) 4-pentoxybenzoate
(4-non-8-enoxyphenyl) 4-pentoxybenzoate (PubChem CID 54371747) has the molecular formula C27H36O4
and a molecular weight of 424.58 g/mol. Its IUPAC name is (4-non-8-enoxyphenyl) 4-pentoxybenzoate.
Molecular Properties
| Compound Name | (4-non-8-enoxyphenyl) 4-pentoxybenzoate |
| PubChem CID | 54371747 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (4-non-8-enoxyphenyl) 4-pentoxybenzoate |
| SMILES | C=CCCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H36O4/c1-3-5-7-8-9-10-12-22-30-25-17-19-26(20-18-25)31-27(28)23-13-15-24(16-14-23)29-21-11-6-4-2/h3,13-20H,1,4-12,21-22H2,2H3 |
| InChIKey | UTRNNFPNZQUZKS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-non-8-enoxyphenyl) 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-non-8-enoxyphenyl) 4-pentoxybenzoate?
The IUPAC name of (4-non-8-enoxyphenyl) 4-pentoxybenzoate (CID 54371747) is (4-non-8-enoxyphenyl) 4-pentoxybenzoate.
What is the SMILES notation for (4-non-8-enoxyphenyl) 4-pentoxybenzoate?
The canonical SMILES for (4-non-8-enoxyphenyl) 4-pentoxybenzoate is C=CCCCCCCCOc1ccc(OC(=O)c2ccc(OCCCCC)cc2)cc1.
What is the InChIKey of (4-non-8-enoxyphenyl) 4-pentoxybenzoate?
The InChIKey is UTRNNFPNZQUZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36O4/c1-3-5-7-8-9-10-12-22-30-25-17-19-26(20-18-25)31-27(28)23-13-15-24(16-14-23)29-21-11-6-4-2/h3,13-20H,1,4-12,21-22H2,2H3.
What are the key properties of (4-non-8-enoxyphenyl) 4-pentoxybenzoate?
(4-non-8-enoxyphenyl) 4-pentoxybenzoate has a molecular weight of 424.58 g/mol, XLogP of 7.38, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-non-8-enoxyphenyl) 4-pentoxybenzoate is sourced from PubChem (CID 54371747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).