About (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate
(4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate (PubChem CID 86174635) has the molecular formula C25H30O4
and a molecular weight of 394.51 g/mol. Its IUPAC name is (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate.
Molecular Properties
| Compound Name | (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate |
| PubChem CID | 86174635 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate |
| SMILES | C=CCCCCOc1ccc(OC(=O)c2ccc(OCCCCC=C)cc2)cc1 |
| InChI | InChI=1S/C25H30O4/c1-3-5-7-9-19-27-22-13-11-21(12-14-22)25(26)29-24-17-15-23(16-18-24)28-20-10-8-6-4-2/h3-4,11-18H,1-2,5-10,19-20H2 |
| InChIKey | FTZLIXGVZAXNJT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate?
The IUPAC name of (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate (CID 86174635) is (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate.
What is the SMILES notation for (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate?
The canonical SMILES for (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate is C=CCCCCOc1ccc(OC(=O)c2ccc(OCCCCC=C)cc2)cc1.
What is the InChIKey of (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate?
The InChIKey is FTZLIXGVZAXNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30O4/c1-3-5-7-9-19-27-22-13-11-21(12-14-22)25(26)29-24-17-15-23(16-18-24)28-20-10-8-6-4-2/h3-4,11-18H,1-2,5-10,19-20H2.
What are the key properties of (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate?
(4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate has a molecular weight of 394.51 g/mol, XLogP of 6.38, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hex-5-enoxyphenyl) 4-hex-5-enoxybenzoate is sourced from PubChem (CID 86174635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).