C54H62O6 — CID 101351833
[3-[4-(4-undec-10-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-undec-10-enoxyphenyl)benzoate (PubChem CID 101351833) has the molecular formula C54H62O6 and a molecular weight of 807.08 g/mol. Its IUPAC name is [3-[4-(4-undec-10-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-undec-10-enoxyphenyl)benzoate.
| Compound Name | [3-[4-(4-undec-10-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-undec-10-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101351833 |
| Molecular Formula | C54H62O6 |
| Molecular Weight | 807.08 g/mol |
| Exact Mass | 806.45 |
| IUPAC Name | [3-[4-(4-undec-10-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-undec-10-enoxyphenyl)benzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(-c5ccc(OCCCCCCCCCC=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C54H62O6/c1-3-5-7-9-11-13-15-17-19-40-57-49-36-32-45(33-37-49)43-24-28-47(29-25-43)53(55)59-51-22-21-23-52(42-51)60-54(56)48-30-26-44(27-31-48)46-34-38-50(39-35-46)58-41-20-18-16-14-12-10-8-6-4-2/h3-4,21-39,42H,1-2,5-20,40-41H2 |
| InChIKey | XZFKFXKHYDZFSB-UHFFFAOYSA-N |
| XLogP | 14.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.08 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|