C56H61ClO10 — CID 90825906
[4-[4-chloro-3-[4-(4-undec-10-enoxybenzoyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-undec-10-enoxybenzoate (PubChem CID 90825906) has the molecular formula C56H61ClO10 and a molecular weight of 929.55 g/mol. Its IUPAC name is [4-[4-chloro-3-[4-(4-undec-10-enoxybenzoyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-undec-10-enoxybenzoate.
| Compound Name | [4-[4-chloro-3-[4-(4-undec-10-enoxybenzoyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-undec-10-enoxybenzoate |
|---|---|
| PubChem CID | 90825906 |
| Molecular Formula | C56H61ClO10 |
| Molecular Weight | 929.55 g/mol |
| Exact Mass | 928.40 |
| IUPAC Name | [4-[4-chloro-3-[4-(4-undec-10-enoxybenzoyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-undec-10-enoxybenzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(Cl)c(OC(=O)c4ccc(OC(=O)c5ccc(OCCCCCCCCCC=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C56H61ClO10/c1-3-5-7-9-11-13-15-17-19-39-62-46-29-21-42(22-30-46)53(58)64-48-33-25-44(26-34-48)55(60)66-50-37-38-51(57)52(41-50)67-56(61)45-27-35-49(36-28-45)65-54(59)43-23-31-47(32-24-43)63-40-20-18-16-14-12-10-8-6-4-2/h3-4,21-38,41H,1-2,5-20,39-40H2 |
| InChIKey | AKKWPASVLOXNJQ-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.55 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|