C52H58O6 — CID 101351837
[3-[4-(4-dec-9-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-dec-9-enoxyphenyl)benzoate (PubChem CID 101351837) has the molecular formula C52H58O6 and a molecular weight of 779.03 g/mol. Its IUPAC name is [3-[4-(4-dec-9-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-dec-9-enoxyphenyl)benzoate.
| Compound Name | [3-[4-(4-dec-9-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-dec-9-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101351837 |
| Molecular Formula | C52H58O6 |
| Molecular Weight | 779.03 g/mol |
| Exact Mass | 778.42 |
| IUPAC Name | [3-[4-(4-dec-9-enoxyphenyl)benzoyl]oxyphenyl] 4-(4-dec-9-enoxyphenyl)benzoate |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(-c5ccc(OCCCCCCCCC=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C52H58O6/c1-3-5-7-9-11-13-15-17-38-55-47-34-30-43(31-35-47)41-22-26-45(27-23-41)51(53)57-49-20-19-21-50(40-49)58-52(54)46-28-24-42(25-29-46)44-32-36-48(37-33-44)56-39-18-16-14-12-10-8-6-4-2/h3-4,19-37,40H,1-2,5-18,38-39H2 |
| InChIKey | QRFIJNSYMQFSBQ-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.03 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|