C36H46O4 — CID 54140837
(4-dec-9-enoxyphenyl) 4-[4-[(4S)-4-methylhexoxy]phenyl]benzoate (PubChem CID 54140837) has the molecular formula C36H46O4 and a molecular weight of 542.76 g/mol. Its IUPAC name is (4-dec-9-enoxyphenyl) 4-[4-[(4S)-4-methylhexoxy]phenyl]benzoate.
| Compound Name | (4-dec-9-enoxyphenyl) 4-[4-[(4S)-4-methylhexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 54140837 |
| Molecular Formula | C36H46O4 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (4-dec-9-enoxyphenyl) 4-[4-[(4S)-4-methylhexoxy]phenyl]benzoate |
| SMILES | C=CCCCCCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(OCCC[C@@H](C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H46O4/c1-4-6-7-8-9-10-11-12-27-38-34-23-25-35(26-24-34)40-36(37)32-17-15-30(16-18-32)31-19-21-33(22-20-31)39-28-13-14-29(3)5-2/h4,15-26,29H,1,5-14,27-28H2,2-3H3/t29-/m0/s1 |
| InChIKey | OAZBBHHVMPCYLI-LJAQVGFWSA-N |
| XLogP | 10.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|