C29H39ClO4 — CID 102094324
[4-[(2S)-2-methylbutoxy]phenyl] 3-chloro-4-undec-10-enoxybenzoate (PubChem CID 102094324) has the molecular formula C29H39ClO4 and a molecular weight of 487.08 g/mol. Its IUPAC name is [4-[(2S)-2-methylbutoxy]phenyl] 3-chloro-4-undec-10-enoxybenzoate.
| Compound Name | [4-[(2S)-2-methylbutoxy]phenyl] 3-chloro-4-undec-10-enoxybenzoate |
|---|---|
| PubChem CID | 102094324 |
| Molecular Formula | C29H39ClO4 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | [4-[(2S)-2-methylbutoxy]phenyl] 3-chloro-4-undec-10-enoxybenzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(OC[C@@H](C)CC)cc2)cc1Cl |
| InChI | InChI=1S/C29H39ClO4/c1-4-6-7-8-9-10-11-12-13-20-32-28-19-14-24(21-27(28)30)29(31)34-26-17-15-25(16-18-26)33-22-23(3)5-2/h4,14-19,21,23H,1,5-13,20,22H2,2-3H3/t23-/m0/s1 |
| InChIKey | JXEXWZMRXYLSKS-QHCPKHFHSA-N |
| XLogP | 8.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|