C35H45ClO7 — CID 102399665
[4-[4-(2-methylbutoxy)phenyl]phenyl] 3-chloro-4-[6-[3-hydroxy-2-(hydroxymethyl)-2-methylpropoxy]hexoxy]benzoate (PubChem CID 102399665) has the molecular formula C35H45ClO7 and a molecular weight of 613.19 g/mol. Its IUPAC name is [4-[4-(2-methylbutoxy)phenyl]phenyl] 3-chloro-4-[6-[3-hydroxy-2-(hydroxymethyl)-2-methylpropoxy]hexoxy]benzoate.
| Compound Name | [4-[4-(2-methylbutoxy)phenyl]phenyl] 3-chloro-4-[6-[3-hydroxy-2-(hydroxymethyl)-2-methylpropoxy]hexoxy]benzoate |
|---|---|
| PubChem CID | 102399665 |
| Molecular Formula | C35H45ClO7 |
| Molecular Weight | 613.19 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | [4-[4-(2-methylbutoxy)phenyl]phenyl] 3-chloro-4-[6-[3-hydroxy-2-(hydroxymethyl)-2-methylpropoxy]hexoxy]benzoate |
| SMILES | CCC(C)COc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCCOCC(C)(CO)CO)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C35H45ClO7/c1-4-26(2)22-42-30-14-9-27(10-15-30)28-11-16-31(17-12-28)43-34(39)29-13-18-33(32(36)21-29)41-20-8-6-5-7-19-40-25-35(3,23-37)24-38/h9-18,21,26,37-38H,4-8,19-20,22-25H2,1-3H3 |
| InChIKey | OMTQMMLVSKHXJJ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.19 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|