C33H38Cl2O5 — CID 14533682
[(2S)-2-methylbutyl] 2-chloro-4-[4-(3-chloro-4-octoxyphenyl)benzoyl]oxybenzoate (PubChem CID 14533682) has the molecular formula C33H38Cl2O5 and a molecular weight of 585.57 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 2-chloro-4-[4-(3-chloro-4-octoxyphenyl)benzoyl]oxybenzoate.
| Compound Name | [(2S)-2-methylbutyl] 2-chloro-4-[4-(3-chloro-4-octoxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 14533682 |
| Molecular Formula | C33H38Cl2O5 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | [(2S)-2-methylbutyl] 2-chloro-4-[4-(3-chloro-4-octoxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC[C@@H](C)CC)c(Cl)c3)cc2)cc1Cl |
| InChI | InChI=1S/C33H38Cl2O5/c1-4-6-7-8-9-10-19-38-31-18-15-26(20-30(31)35)24-11-13-25(14-12-24)32(36)40-27-16-17-28(29(34)21-27)33(37)39-22-23(3)5-2/h11-18,20-21,23H,4-10,19,22H2,1-3H3/t23-/m0/s1 |
| InChIKey | TXVOVRMUPYTBLQ-QHCPKHFHSA-N |
| XLogP | 9.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|