C40H51ClO7 — CID 101067922
[4-[(2S)-1-nonoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(3-chloro-4-octoxyphenyl)benzoate (PubChem CID 101067922) has the molecular formula C40H51ClO7 and a molecular weight of 679.29 g/mol. Its IUPAC name is [4-[(2S)-1-nonoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(3-chloro-4-octoxyphenyl)benzoate.
| Compound Name | [4-[(2S)-1-nonoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(3-chloro-4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101067922 |
| Molecular Formula | C40H51ClO7 |
| Molecular Weight | 679.29 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | [4-[(2S)-1-nonoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(3-chloro-4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCCOC(=O)[C@H](C)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCCC)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C40H51ClO7/c1-4-6-8-10-12-14-16-28-46-38(42)30(3)47-39(43)33-21-24-35(25-22-33)48-40(44)32-19-17-31(18-20-32)34-23-26-37(36(41)29-34)45-27-15-13-11-9-7-5-2/h17-26,29-30H,4-16,27-28H2,1-3H3/t30-/m0/s1 |
| InChIKey | QDYKFPYBBKFXCN-PMERELPUSA-N |
| XLogP | 10.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.29 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|