C37H47ClO6 — CID 101357368
[4-[4-[2-(2-methylbutoxy)propanoyloxy]phenyl]phenyl] 3-chloro-4-decoxybenzoate (PubChem CID 101357368) has the molecular formula C37H47ClO6 and a molecular weight of 623.23 g/mol. Its IUPAC name is [4-[4-[2-(2-methylbutoxy)propanoyloxy]phenyl]phenyl] 3-chloro-4-decoxybenzoate.
| Compound Name | [4-[4-[2-(2-methylbutoxy)propanoyloxy]phenyl]phenyl] 3-chloro-4-decoxybenzoate |
|---|---|
| PubChem CID | 101357368 |
| Molecular Formula | C37H47ClO6 |
| Molecular Weight | 623.23 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | [4-[4-[2-(2-methylbutoxy)propanoyloxy]phenyl]phenyl] 3-chloro-4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OC(=O)C(C)OCC(C)CC)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C37H47ClO6/c1-5-7-8-9-10-11-12-13-24-41-35-23-18-31(25-34(35)38)37(40)44-33-21-16-30(17-22-33)29-14-19-32(20-15-29)43-36(39)28(4)42-26-27(3)6-2/h14-23,25,27-28H,5-13,24,26H2,1-4H3 |
| InChIKey | DGWCJYFCNJRTAF-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.23 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|