C25H31ClO5 — CID 14533580
[(2S)-2-methylbutyl] 3-chloro-4-(4-hexoxybenzoyl)oxybenzoate (PubChem CID 14533580) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 3-chloro-4-(4-hexoxybenzoyl)oxybenzoate.
| Compound Name | [(2S)-2-methylbutyl] 3-chloro-4-(4-hexoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 14533580 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(2S)-2-methylbutyl] 3-chloro-4-(4-hexoxybenzoyl)oxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OC[C@@H](C)CC)cc2Cl)cc1 |
| InChI | InChI=1S/C25H31ClO5/c1-4-6-7-8-15-29-21-12-9-19(10-13-21)25(28)31-23-14-11-20(16-22(23)26)24(27)30-17-18(3)5-2/h9-14,16,18H,4-8,15,17H2,1-3H3/t18-/m0/s1 |
| InChIKey | MZJXQBMIBAPMKK-SFHVURJKSA-N |
| XLogP | 6.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|