C33H40O5 — CID 15752010
2-methylbutyl 4-[4-(4-octoxybenzoyl)oxyphenyl]benzoate (PubChem CID 15752010) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is 2-methylbutyl 4-[4-(4-octoxybenzoyl)oxyphenyl]benzoate.
| Compound Name | 2-methylbutyl 4-[4-(4-octoxybenzoyl)oxyphenyl]benzoate |
|---|---|
| PubChem CID | 15752010 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 2-methylbutyl 4-[4-(4-octoxybenzoyl)oxyphenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H40O5/c1-4-6-7-8-9-10-23-36-30-19-17-29(18-20-30)33(35)38-31-21-15-27(16-22-31)26-11-13-28(14-12-26)32(34)37-24-25(3)5-2/h11-22,25H,4-10,23-24H2,1-3H3 |
| InChIKey | VUFACZOSLJORQW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|