C35H44O5 — CID 19863196
[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]phenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 19863196) has the molecular formula C35H44O5 and a molecular weight of 544.73 g/mol. Its IUPAC name is [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]phenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]phenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19863196 |
| Molecular Formula | C35H44O5 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]phenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(C)C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H44O5/c1-5-7-8-9-10-11-24-38-32-20-18-30(19-21-32)29-12-14-31(15-13-29)35(37)40-33-22-16-28(17-23-33)27(4)34(36)39-25-26(3)6-2/h12-23,26-27H,5-11,24-25H2,1-4H3 |
| InChIKey | IDVVXTQUWZLQPP-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|