C37H48O5 — CID 70427307
[4-[3-(2-methylbutoxy)-3-oxopropyl]phenyl] 4-(4-decoxyphenyl)benzoate (PubChem CID 70427307) has the molecular formula C37H48O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is [4-[3-(2-methylbutoxy)-3-oxopropyl]phenyl] 4-(4-decoxyphenyl)benzoate.
| Compound Name | [4-[3-(2-methylbutoxy)-3-oxopropyl]phenyl] 4-(4-decoxyphenyl)benzoate |
|---|---|
| PubChem CID | 70427307 |
| Molecular Formula | C37H48O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | [4-[3-(2-methylbutoxy)-3-oxopropyl]phenyl] 4-(4-decoxyphenyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(CCC(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H48O5/c1-4-6-7-8-9-10-11-12-27-40-34-24-20-32(21-25-34)31-16-18-33(19-17-31)37(39)42-35-22-13-30(14-23-35)15-26-36(38)41-28-29(3)5-2/h13-14,16-25,29H,4-12,15,26-28H2,1-3H3 |
| InChIKey | HGYOJIIJKJFKIG-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|