About (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate
(4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate (PubChem CID 14793865) has the molecular formula C30H44O4
and a molecular weight of 468.68 g/mol. Its IUPAC name is (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate.
Molecular Properties
| Compound Name | (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate |
| PubChem CID | 14793865 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ccc(CCOC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C30H44O4/c1-4-6-7-8-9-10-11-12-22-33-28-17-19-29(20-18-28)34-30(31)27-15-13-26(14-16-27)21-23-32-24-25(3)5-2/h13-20,25H,4-12,21-24H2,1-3H3/t25-/m0/s1 |
| InChIKey | LWSCGGRWMLHLRK-VWLOTQADSA-N |
| XLogP | 8.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate?
The IUPAC name of (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate (CID 14793865) is (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate.
What is the SMILES notation for (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate?
The canonical SMILES for (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate is CCCCCCCCCCOc1ccc(OC(=O)c2ccc(CCOC[C@@H](C)CC)cc2)cc1.
What is the InChIKey of (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate?
The InChIKey is LWSCGGRWMLHLRK-VWLOTQADSA-N. The full InChI is InChI=1S/C30H44O4/c1-4-6-7-8-9-10-11-12-22-33-28-17-19-29(20-18-28)34-30(31)27-15-13-26(14-16-27)21-23-32-24-25(3)5-2/h13-20,25H,4-12,21-24H2,1-3H3/t25-/m0/s1.
What are the key properties of (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate?
(4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate has a molecular weight of 468.68 g/mol, XLogP of 8.03, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-decoxyphenyl) 4-[2-[(2S)-2-methylbutoxy]ethyl]benzoate is sourced from PubChem (CID 14793865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).