C28H40O3 — CID 86030946
2-methylbutyl 4-(4-decoxyphenyl)benzoate (PubChem CID 86030946) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-methylbutyl 4-(4-decoxyphenyl)benzoate.
| Compound Name | 2-methylbutyl 4-(4-decoxyphenyl)benzoate |
|---|---|
| PubChem CID | 86030946 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-methylbutyl 4-(4-decoxyphenyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)OCC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C28H40O3/c1-4-6-7-8-9-10-11-12-21-30-27-19-17-25(18-20-27)24-13-15-26(16-14-24)28(29)31-22-23(3)5-2/h13-20,23H,4-12,21-22H2,1-3H3 |
| InChIKey | SLHVVSCKZLATTH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|