C26H36O2 — CID 2851943
2-methylbutyl 4-(4-octylphenyl)benzoate (PubChem CID 2851943) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-methylbutyl 4-(4-octylphenyl)benzoate.
| Compound Name | 2-methylbutyl 4-(4-octylphenyl)benzoate |
|---|---|
| PubChem CID | 2851943 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-methylbutyl 4-(4-octylphenyl)benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)OCC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C26H36O2/c1-4-6-7-8-9-10-11-22-12-14-23(15-13-22)24-16-18-25(19-17-24)26(27)28-20-21(3)5-2/h12-19,21H,4-11,20H2,1-3H3 |
| InChIKey | UZGDQUWQCZLUPF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|