C25H35NO2 — CID 14070042
2-methylbutyl 4-(5-octyl-2-pyridinyl)benzoate (PubChem CID 14070042) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-methylbutyl 4-(5-octyl-2-pyridinyl)benzoate.
| Compound Name | 2-methylbutyl 4-(5-octyl-2-pyridinyl)benzoate |
|---|---|
| PubChem CID | 14070042 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-methylbutyl 4-(5-octyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)OCC(C)CC)cc2)nc1 |
| InChI | InChI=1S/C25H35NO2/c1-4-6-7-8-9-10-11-21-12-17-24(26-18-21)22-13-15-23(16-14-22)25(27)28-19-20(3)5-2/h12-18,20H,4-11,19H2,1-3H3 |
| InChIKey | JBZVEOPLKWWSGB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|