About octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate
octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate (PubChem CID 54176433) has the molecular formula C33H43NO2
and a molecular weight of 485.71 g/mol. Its IUPAC name is octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate.
Molecular Properties
| Compound Name | octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate |
| PubChem CID | 54176433 |
| Molecular Formula | C33H43NO2 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C)CCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H43NO2/c1-4-6-8-10-12-14-27-15-17-29(18-16-27)32-24-23-31(25-34-32)28-19-21-30(22-20-28)33(35)36-26(3)13-11-9-7-5-2/h15-26H,4-14H2,1-3H3 |
| InChIKey | OYSBZGHAEUJLNN-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate?
The IUPAC name of octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate (CID 54176433) is octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate.
What is the SMILES notation for octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate?
The canonical SMILES for octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate is CCCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C)CCCCCC)cc3)cn2)cc1.
What is the InChIKey of octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate?
The InChIKey is OYSBZGHAEUJLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H43NO2/c1-4-6-8-10-12-14-27-15-17-29(18-16-27)32-24-23-31(25-34-32)28-19-21-30(22-20-28)33(35)36-26(3)13-11-9-7-5-2/h15-26H,4-14H2,1-3H3.
What are the key properties of octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate?
octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate has a molecular weight of 485.71 g/mol, XLogP of 9.44, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 4-[6-(4-heptylphenyl)-3-pyridinyl]benzoate is sourced from PubChem (CID 54176433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).