About 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate
3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate (PubChem CID 54506988) has the molecular formula C24H31NO3
and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate.
Molecular Properties
| Compound Name | 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate |
| PubChem CID | 54506988 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(C(=O)OC(C)C(=O)CCC)cc2)nc1 |
| InChI | InChI=1S/C24H31NO3/c1-4-6-7-8-10-19-11-16-22(25-17-19)20-12-14-21(15-13-20)24(27)28-18(3)23(26)9-5-2/h11-18H,4-10H2,1-3H3 |
| InChIKey | YGKMZMYOIUMMCK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate?
The IUPAC name of 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate (CID 54506988) is 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate.
What is the SMILES notation for 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate?
The canonical SMILES for 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate is CCCCCCc1ccc(-c2ccc(C(=O)OC(C)C(=O)CCC)cc2)nc1.
What is the InChIKey of 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate?
The InChIKey is YGKMZMYOIUMMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO3/c1-4-6-7-8-10-19-11-16-22(25-17-19)20-12-14-21(15-13-20)24(27)28-18(3)23(26)9-5-2/h11-18H,4-10H2,1-3H3.
What are the key properties of 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate?
3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate has a molecular weight of 381.52 g/mol, XLogP of 5.79, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexan-2-yl 4-(5-hexyl-2-pyridinyl)benzoate is sourced from PubChem (CID 54506988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).