C57H78F6N2O4 — CID 161170557
3-(trifluoromethyl)nonyl 4-(5-heptyl-2-pyridinyl)benzoate;3-(trifluoromethyl)nonyl 4-(5-hexyl-2-pyridinyl)benzoate (PubChem CID 161170557) has the molecular formula C57H78F6N2O4 and a molecular weight of 969.25 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 4-(5-heptyl-2-pyridinyl)benzoate;3-(trifluoromethyl)nonyl 4-(5-hexyl-2-pyridinyl)benzoate.
| Compound Name | 3-(trifluoromethyl)nonyl 4-(5-heptyl-2-pyridinyl)benzoate;3-(trifluoromethyl)nonyl 4-(5-hexyl-2-pyridinyl)benzoate |
|---|---|
| PubChem CID | 161170557 |
| Molecular Formula | C57H78F6N2O4 |
| Molecular Weight | 969.25 g/mol |
| Exact Mass | 968.59 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 4-(5-heptyl-2-pyridinyl)benzoate;3-(trifluoromethyl)nonyl 4-(5-hexyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)OCCC(CCCCCC)C(F)(F)F)cc2)nc1.CCCCCCc1ccc(-c2ccc(C(=O)OCCC(CCCCCC)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C29H40F3NO2.C28H38F3NO2/c1-3-5-7-9-10-12-23-14-19-27(33-22-23)24-15-17-25(18-16-24)28(34)35-21-20-26(29(30,31)32)13-11-8-6-4-2;1-3-5-7-9-11-22-13-18-26(32-21-22)23-14-16-24(17-15-23)27(33)34-20-19-25(28(29,30)31)12-10-8-6-4-2/h14-19,22,26H,3-13,20-21H2,1-2H3;13-18,21,25H,3-12,19-20H2,1-2H3 |
| InChIKey | URCSKQPXUCCSNL-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.25 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|