C37H48F3NO3 — CID 139802708
6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-decylphenyl)-3-pyridinyl]benzoate (PubChem CID 139802708) has the molecular formula C37H48F3NO3 and a molecular weight of 611.79 g/mol. Its IUPAC name is 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-decylphenyl)-3-pyridinyl]benzoate.
| Compound Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-decylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 139802708 |
| Molecular Formula | C37H48F3NO3 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-decylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OCCCCCCOC(C)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C37H48F3NO3/c1-3-4-5-6-7-8-9-12-15-30-16-18-32(19-17-30)35-25-24-34(28-41-35)31-20-22-33(23-21-31)36(42)44-27-14-11-10-13-26-43-29(2)37(38,39)40/h16-25,28-29H,3-15,26-27H2,1-2H3 |
| InChIKey | FADRLESKQMDTHL-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|