C31H36F3NO3 — CID 139802712
6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-butylphenyl)-3-pyridinyl]benzoate (PubChem CID 139802712) has the molecular formula C31H36F3NO3 and a molecular weight of 527.63 g/mol. Its IUPAC name is 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-butylphenyl)-3-pyridinyl]benzoate.
| Compound Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-butylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 139802712 |
| Molecular Formula | C31H36F3NO3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 6-(1,1,1-trifluoropropan-2-yloxy)hexyl 4-[6-(4-butylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc(C(=O)OCCCCCCOC(C)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H36F3NO3/c1-3-4-9-24-10-12-26(13-11-24)29-19-18-28(22-35-29)25-14-16-27(17-15-25)30(36)38-21-8-6-5-7-20-37-23(2)31(32,33)34/h10-19,22-23H,3-9,20-21H2,1-2H3 |
| InChIKey | VSGYBSXXNSWNKO-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|